C13H20Cl2IN3 — CID 111310357
1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-propylguanidine;hydroiodide (PubChem CID 111310357) has the molecular formula C13H20Cl2IN3 and a molecular weight of 416.13 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-propylguanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111310357 |
| Molecular Formula | C13H20Cl2IN3 |
| Molecular Weight | 416.13 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-propylguanidine;hydroiodide |
| SMILES | CCCN/C(=N\C)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C13H19Cl2N3.HI/c1-4-7-17-13(16-3)18-9(2)11-6-5-10(14)8-12(11)15;/h5-6,8-9H,4,7H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | VDGDFSMIPKZOBE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.13 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|