C14H23Cl2IN4O2S — CID 111310731
1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide (PubChem CID 111310731) has the molecular formula C14H23Cl2IN4O2S and a molecular weight of 509.24 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111310731 |
| Molecular Formula | C14H23Cl2IN4O2S |
| Molecular Weight | 509.24 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C14H22Cl2N4O2S.HI/c1-4-17-14(18-7-8-19-23(3,21)22)20-10(2)12-6-5-11(15)9-13(12)16;/h5-6,9-10,19H,4,7-8H2,1-3H3,(H2,17,18,20);1H |
| InChIKey | WOLZJHNUXNBQHC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|