C18H27Cl2IN4O — CID 111310213
1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111310213) has the molecular formula C18H27Cl2IN4O and a molecular weight of 513.25 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111310213 |
| Molecular Formula | C18H27Cl2IN4O |
| Molecular Weight | 513.25 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCCCC1)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H26Cl2N4O.HI/c1-3-21-18(22-12-17(25)24-9-5-4-6-10-24)23-13(2)15-8-7-14(19)11-16(15)20;/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | BUYRUVFZSRVSGZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|