C17H23Cl2IN6 — CID 111310291
1-[1-(2,4-dichlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide (PubChem CID 111310291) has the molecular formula C17H23Cl2IN6 and a molecular weight of 509.22 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111310291 |
| Molecular Formula | C17H23Cl2IN6 |
| Molecular Weight | 509.22 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H22Cl2N6.HI/c1-3-20-17(21-10-16-24-23-15-5-4-8-25(15)16)22-11(2)13-7-6-12(18)9-14(13)19;/h6-7,9,11H,3-5,8,10H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | OAWMIXGJAYQZMP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.22 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|