C18H24Cl2N6 — CID 111039217
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine (PubChem CID 111039217) has the molecular formula C18H24Cl2N6 and a molecular weight of 395.34 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111039217 |
| Molecular Formula | C18H24Cl2N6 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
| SMILES | CC(N/C(N)=N/CCc1nnc2n1CCCCC2)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H24Cl2N6/c1-12(14-7-6-13(19)11-15(14)20)23-18(21)22-9-8-17-25-24-16-5-3-2-4-10-26(16)17/h6-7,11-12H,2-5,8-10H2,1H3,(H3,21,22,23) |
| InChIKey | JQQJLEYYAGMIBY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|