C17H24Cl2IN5 — CID 111068881
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111068881) has the molecular formula C17H24Cl2IN5 and a molecular weight of 496.22 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111068881 |
| Molecular Formula | C17H24Cl2IN5 |
| Molecular Weight | 496.22 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | Cc1nn(C)c(C)c1CC/N=C(\N)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H23Cl2N5.HI/c1-10(15-6-5-13(18)9-16(15)19)22-17(20)21-8-7-14-11(2)23-24(4)12(14)3;/h5-6,9-10H,7-8H2,1-4H3,(H3,20,21,22);1H |
| InChIKey | YKFBYOGEADIWAE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|