C14H18Cl2IN5 — CID 111081499
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111081499) has the molecular formula C14H18Cl2IN5 and a molecular weight of 454.14 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111081499 |
| Molecular Formula | C14H18Cl2IN5 |
| Molecular Weight | 454.14 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/Cc1cnn(C)c1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C14H17Cl2N5.HI/c1-9(12-4-3-11(15)5-13(12)16)20-14(17)18-6-10-7-19-21(2)8-10;/h3-5,7-9H,6H2,1-2H3,(H3,17,18,20);1H |
| InChIKey | YPOHIMTXWFOMCY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.14 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|