C18H23Cl2IN4O2S — CID 111037915
1-[1-(2,4-dichlorophenyl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111037915) has the molecular formula C18H23Cl2IN4O2S and a molecular weight of 557.29 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111037915 |
| Molecular Formula | C18H23Cl2IN4O2S |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 556.00 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CNS(=O)(=O)Cc1ccc(C/N=C(\N)NC(C)c2ccc(Cl)cc2Cl)cc1.I |
| InChI | InChI=1S/C18H22Cl2N4O2S.HI/c1-12(16-8-7-15(19)9-17(16)20)24-18(21)23-10-13-3-5-14(6-4-13)11-27(25,26)22-2;/h3-9,12,22H,10-11H2,1-2H3,(H3,21,23,24);1H |
| InChIKey | QBQNAUHQWDRVLU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|