C14H20Cl2N4O — CID 111072627
3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 111072627) has the molecular formula C14H20Cl2N4O and a molecular weight of 331.25 g/mol. Its IUPAC name is 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111072627 |
| Molecular Formula | C14H20Cl2N4O |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CC(N/C(N)=N/CC(C)(C)C(N)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N4O/c1-8(10-5-4-9(15)6-11(10)16)20-13(18)19-7-14(2,3)12(17)21/h4-6,8H,7H2,1-3H3,(H2,17,21)(H3,18,19,20) |
| InChIKey | GEIJNTHERVNQPQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|