C17H27Cl2IN4O2 — CID 111044747
tert-butyl N-[3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide (PubChem CID 111044747) has the molecular formula C17H27Cl2IN4O2 and a molecular weight of 517.24 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111044747 |
| Molecular Formula | C17H27Cl2IN4O2 |
| Molecular Weight | 517.24 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | tert-butyl N-[3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propyl]carbamate;hydroiodide |
| SMILES | CC(N/C(N)=N/CCCNC(=O)OC(C)(C)C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H26Cl2N4O2.HI/c1-11(13-7-6-12(18)10-14(13)19)23-15(20)21-8-5-9-22-16(24)25-17(2,3)4;/h6-7,10-11H,5,8-9H2,1-4H3,(H,22,24)(H3,20,21,23);1H |
| InChIKey | FLUUGBCMSUMGGS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|