C13H18Cl2N2O2 — CID 107237339
tert-butyl N-[1-(2,4-dichlorophenyl)ethylamino]carbamate (PubChem CID 107237339) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.21 g/mol. Its IUPAC name is tert-butyl N-[1-(2,4-dichlorophenyl)ethylamino]carbamate.
| Compound Name | tert-butyl N-[1-(2,4-dichlorophenyl)ethylamino]carbamate |
|---|---|
| PubChem CID | 107237339 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | tert-butyl N-[1-(2,4-dichlorophenyl)ethylamino]carbamate |
| SMILES | CC(NNC(=O)OC(C)(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-8(10-6-5-9(14)7-11(10)15)16-17-12(18)19-13(2,3)4/h5-8,16H,1-4H3,(H,17,18) |
| InChIKey | ZLIQTAXPDHDVCK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|