C18H29Cl2IN4O2 — CID 110027016
tert-butyl N-[4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]butyl]carbamate;hydroiodide (PubChem CID 110027016) has the molecular formula C18H29Cl2IN4O2 and a molecular weight of 531.27 g/mol. Its IUPAC name is tert-butyl N-[4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]butyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]butyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 110027016 |
| Molecular Formula | C18H29Cl2IN4O2 |
| Molecular Weight | 531.27 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | tert-butyl N-[4-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]butyl]carbamate;hydroiodide |
| SMILES | CC(N/C(N)=N/CCCCNC(=O)OC(C)(C)C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H28Cl2N4O2.HI/c1-12(14-8-7-13(19)11-15(14)20)24-16(21)22-9-5-6-10-23-17(25)26-18(2,3)4;/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,23,25)(H3,21,22,24);1H |
| InChIKey | JBGNROWATNIYDF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|