C17H27Cl2IN4 — CID 111059818
1-[1-(2,4-dichlorophenyl)ethyl]-2-(4-pyrrolidin-1-ylbutyl)guanidine;hydroiodide (PubChem CID 111059818) has the molecular formula C17H27Cl2IN4 and a molecular weight of 485.24 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-(4-pyrrolidin-1-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(4-pyrrolidin-1-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111059818 |
| Molecular Formula | C17H27Cl2IN4 |
| Molecular Weight | 485.24 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(4-pyrrolidin-1-ylbutyl)guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCCCN1CCCC1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H26Cl2N4.HI/c1-13(15-7-6-14(18)12-16(15)19)22-17(20)21-8-2-3-9-23-10-4-5-11-23;/h6-7,12-13H,2-5,8-11H2,1H3,(H3,20,21,22);1H |
| InChIKey | RQACIWSKAJXSAX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|