C19H26Cl2IN7 — CID 111062162
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111062162) has the molecular formula C19H26Cl2IN7 and a molecular weight of 550.28 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111062162 |
| Molecular Formula | C19H26Cl2IN7 |
| Molecular Weight | 550.28 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCN1CCN(c2ncccn2)CC1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C19H25Cl2N7.HI/c1-14(16-4-3-15(20)13-17(16)21)26-18(22)23-7-8-27-9-11-28(12-10-27)19-24-5-2-6-25-19;/h2-6,13-14H,7-12H2,1H3,(H3,22,23,26);1H |
| InChIKey | MLCTWVVVIQXLND-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|