C16H19Cl2IN4O — CID 111802911
1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide (PubChem CID 111802911) has the molecular formula C16H19Cl2IN4O and a molecular weight of 481.17 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111802911 |
| Molecular Formula | C16H19Cl2IN4O |
| Molecular Weight | 481.17 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCOc1cccnc1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C16H18Cl2N4O.HI/c1-11(14-5-4-12(17)9-15(14)18)22-16(19)21-7-8-23-13-3-2-6-20-10-13;/h2-6,9-11H,7-8H2,1H3,(H3,19,21,22);1H |
| InChIKey | HXISBXRYEQRRMP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.17 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|