C18H21Cl2N3O3S — CID 111805006
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine (PubChem CID 111805006) has the molecular formula C18H21Cl2N3O3S and a molecular weight of 430.36 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111805006 |
| Molecular Formula | C18H21Cl2N3O3S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine |
| SMILES | CC(N/C(N)=N/CCOc1ccc(S(C)(=O)=O)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2N3O3S/c1-12(16-8-3-13(19)11-17(16)20)23-18(21)22-9-10-26-14-4-6-15(7-5-14)27(2,24)25/h3-8,11-12H,9-10H2,1-2H3,(H3,21,22,23) |
| InChIKey | MJAJDYSODIKCLX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|