C16H23Cl2N3O2 — CID 111804944
tert-butyl 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propanoate (PubChem CID 111804944) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is tert-butyl 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propanoate.
| Compound Name | tert-butyl 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propanoate |
|---|---|
| PubChem CID | 111804944 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | tert-butyl 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]propanoate |
| SMILES | CC(N/C(N)=N/CCC(=O)OC(C)(C)C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H23Cl2N3O2/c1-10(12-6-5-11(17)9-13(12)18)21-15(19)20-8-7-14(22)23-16(2,3)4/h5-6,9-10H,7-8H2,1-4H3,(H3,19,20,21) |
| InChIKey | RMHPKUIZTWWXCN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|