C18H21Cl2N5O — CID 111074267
3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide (PubChem CID 111074267) has the molecular formula C18H21Cl2N5O and a molecular weight of 394.31 g/mol. Its IUPAC name is 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 111074267 |
| Molecular Formula | C18H21Cl2N5O |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]-N-(6-methyl-2-pyridinyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CC/N=C(\N)NC(C)c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C18H21Cl2N5O/c1-11-4-3-5-16(23-11)25-17(26)8-9-22-18(21)24-12(2)14-7-6-13(19)10-15(14)20/h3-7,10,12H,8-9H2,1-2H3,(H3,21,22,24)(H,23,25,26) |
| InChIKey | QDPLDDYBHJODFR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|