C17H20Cl2IN5O — CID 111055650
N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111055650) has the molecular formula C17H20Cl2IN5O and a molecular weight of 508.19 g/mol. Its IUPAC name is N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111055650 |
| Molecular Formula | C17H20Cl2IN5O |
| Molecular Weight | 508.19 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | N-[2-[[amino-[1-(2,4-dichlorophenyl)ethylamino]methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | CC(N/C(N)=N/CCNC(=O)c1cccnc1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H19Cl2N5O.HI/c1-11(14-5-4-13(18)9-15(14)19)24-17(20)23-8-7-22-16(25)12-3-2-6-21-10-12;/h2-6,9-11H,7-8H2,1H3,(H,22,25)(H3,20,23,24);1H |
| InChIKey | NWFLEHZETDZVMZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|