C13H19Cl2IN4O — CID 111055780
N-[2-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide (PubChem CID 111055780) has the molecular formula C13H19Cl2IN4O and a molecular weight of 445.13 g/mol. Its IUPAC name is N-[2-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 111055780 |
| Molecular Formula | C13H19Cl2IN4O |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | N-[2-[[amino-(propan-2-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
| SMILES | CC(C)N/C(N)=N/CCNC(=O)c1ccc(Cl)c(Cl)c1.I |
| InChI | InChI=1S/C13H18Cl2N4O.HI/c1-8(2)19-13(16)18-6-5-17-12(20)9-3-4-10(14)11(15)7-9;/h3-4,7-8H,5-6H2,1-2H3,(H,17,20)(H3,16,18,19);1H |
| InChIKey | OSGLSKNXYUYJAL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|