C16H17Cl2IN4O — CID 110925367
N-[2-[[amino(anilino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide (PubChem CID 110925367) has the molecular formula C16H17Cl2IN4O and a molecular weight of 479.15 g/mol. Its IUPAC name is N-[2-[[amino(anilino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino(anilino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 110925367 |
| Molecular Formula | C16H17Cl2IN4O |
| Molecular Weight | 479.15 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | N-[2-[[amino(anilino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccc(Cl)c(Cl)c1)Nc1ccccc1 |
| InChI | InChI=1S/C16H16Cl2N4O.HI/c17-13-7-6-11(10-14(13)18)15(23)20-8-9-21-16(19)22-12-4-2-1-3-5-12;/h1-7,10H,8-9H2,(H,20,23)(H3,19,21,22);1H |
| InChIKey | AWARPBBSDSSKJS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.15 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|