C17H20ClIN4O2 — CID 111042937
N-[2-[[amino-(3-methoxyanilino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide (PubChem CID 111042937) has the molecular formula C17H20ClIN4O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is N-[2-[[amino-(3-methoxyanilino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(3-methoxyanilino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 111042937 |
| Molecular Formula | C17H20ClIN4O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | N-[2-[[amino-(3-methoxyanilino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/CCNC(=O)c2ccc(Cl)cc2)c1.I |
| InChI | InChI=1S/C17H19ClN4O2.HI/c1-24-15-4-2-3-14(11-15)22-17(19)21-10-9-20-16(23)12-5-7-13(18)8-6-12;/h2-8,11H,9-10H2,1H3,(H,20,23)(H3,19,21,22);1H |
| InChIKey | VLNQIDACNRRWMT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|