C15H21Cl2IN4O — CID 111055830
N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide (PubChem CID 111055830) has the molecular formula C15H21Cl2IN4O and a molecular weight of 471.17 g/mol. Its IUPAC name is N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 111055830 |
| Molecular Formula | C15H21Cl2IN4O |
| Molecular Weight | 471.17 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccc(Cl)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C15H20Cl2N4O.HI/c16-12-5-4-11(10-13(12)17)14(22)19-6-7-20-15(18)21-8-2-1-3-9-21;/h4-5,10H,1-3,6-9H2,(H2,18,20)(H,19,22);1H |
| InChIKey | YDEJQSGRRIXSJH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|