C16H24IN5O2 — CID 111048623
N-(2-amino-2-oxoethyl)-4-[[[amino(piperidin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111048623) has the molecular formula C16H24IN5O2 and a molecular weight of 445.31 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[amino(piperidin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[amino(piperidin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111048623 |
| Molecular Formula | C16H24IN5O2 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[amino(piperidin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | I.NC(=O)CNC(=O)c1ccc(C/N=C(\N)N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H23N5O2.HI/c17-14(22)11-19-15(23)13-6-4-12(5-7-13)10-20-16(18)21-8-2-1-3-9-21;/h4-7H,1-3,8-11H2,(H2,17,22)(H2,18,20)(H,19,23);1H |
| InChIKey | CNZMIWJTJNGEPP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|