C20H30IN5O4 — CID 111252338
methyl 1-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111252338) has the molecular formula C20H30IN5O4 and a molecular weight of 531.40 g/mol. Its IUPAC name is methyl 1-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111252338 |
| Molecular Formula | C20H30IN5O4 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | methyl 1-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C20H29N5O4.HI/c1-3-22-20(25-10-8-16(9-11-25)19(28)29-2)24-12-14-4-6-15(7-5-14)18(27)23-13-17(21)26;/h4-7,16H,3,8-13H2,1-2H3,(H2,21,26)(H,22,24)(H,23,27);1H |
| InChIKey | ZOECNSNNCIALLV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|