C20H30N6O4 — CID 111163949
ethyl 4-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163949) has the molecular formula C20H30N6O4 and a molecular weight of 418.50 g/mol. Its IUPAC name is ethyl 4-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163949 |
| Molecular Formula | C20H30N6O4 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 4-[N'-[[4-[(2-amino-2-oxoethyl)carbamoyl]phenyl]methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C20H30N6O4/c1-3-22-19(25-9-11-26(12-10-25)20(29)30-4-2)24-13-15-5-7-16(8-6-15)18(28)23-14-17(21)27/h5-8H,3-4,9-14H2,1-2H3,(H2,21,27)(H,22,24)(H,23,28) |
| InChIKey | RDANGCMZBBROIQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|