C21H32N4O2S — CID 111253265
methyl 1-[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111253265) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111253265 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C21H32N4O2S/c1-3-22-21(25-10-8-18(9-11-25)20(26)27-2)23-16-17-4-6-19(7-5-17)24-12-14-28-15-13-24/h4-7,18H,3,8-16H2,1-2H3,(H,22,23) |
| InChIKey | FHDODPWJVPGXSA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|