C16H23BrN4O — CID 111094043
N-[3-[[amino(piperidin-1-yl)methylidene]amino]propyl]-4-bromobenzamide (PubChem CID 111094043) has the molecular formula C16H23BrN4O and a molecular weight of 367.29 g/mol. Its IUPAC name is N-[3-[[amino(piperidin-1-yl)methylidene]amino]propyl]-4-bromobenzamide.
| Compound Name | N-[3-[[amino(piperidin-1-yl)methylidene]amino]propyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 111094043 |
| Molecular Formula | C16H23BrN4O |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[3-[[amino(piperidin-1-yl)methylidene]amino]propyl]-4-bromobenzamide |
| SMILES | N/C(=N\CCCNC(=O)c1ccc(Br)cc1)N1CCCCC1 |
| InChI | InChI=1S/C16H23BrN4O/c17-14-7-5-13(6-8-14)15(22)19-9-4-10-20-16(18)21-11-2-1-3-12-21/h5-8H,1-4,9-12H2,(H2,18,20)(H,19,22) |
| InChIKey | PZHXDPPIJGYTPY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|