C15H22N4O2S — CID 111094339
N-[3-[[amino(thiomorpholin-4-yl)methylidene]amino]propyl]-3-hydroxybenzamide (PubChem CID 111094339) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-[3-[[amino(thiomorpholin-4-yl)methylidene]amino]propyl]-3-hydroxybenzamide.
| Compound Name | N-[3-[[amino(thiomorpholin-4-yl)methylidene]amino]propyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 111094339 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[3-[[amino(thiomorpholin-4-yl)methylidene]amino]propyl]-3-hydroxybenzamide |
| SMILES | N/C(=N\CCCNC(=O)c1cccc(O)c1)N1CCSCC1 |
| InChI | InChI=1S/C15H22N4O2S/c16-15(19-7-9-22-10-8-19)18-6-2-5-17-14(21)12-3-1-4-13(20)11-12/h1,3-4,11,20H,2,5-10H2,(H2,16,18)(H,17,21) |
| InChIKey | VVUGWOFONMCXJZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|