C14H22IN5O — CID 111055652
N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide (PubChem CID 111055652) has the molecular formula C14H22IN5O and a molecular weight of 403.27 g/mol. Its IUPAC name is N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide.
| Compound Name | N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111055652 |
| Molecular Formula | C14H22IN5O |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[2-[[amino(piperidin-1-yl)methylidene]amino]ethyl]pyridine-3-carboxamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1cccnc1)N1CCCCC1 |
| InChI | InChI=1S/C14H21N5O.HI/c15-14(19-9-2-1-3-10-19)18-8-7-17-13(20)12-5-4-6-16-11-12;/h4-6,11H,1-3,7-10H2,(H2,15,18)(H,17,20);1H |
| InChIKey | ONQMXXWWQXTENN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|