C19H29N5O3 — CID 110993273
ethyl 1-[N-ethyl-N'-[2-(pyridine-3-carbonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993273) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-(pyridine-3-carbonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-(pyridine-3-carbonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993273 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-(pyridine-3-carbonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCN/C(=N\CCNC(=O)c1cccnc1)N1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C19H29N5O3/c1-3-21-19(24-12-6-8-16(14-24)18(26)27-4-2)23-11-10-22-17(25)15-7-5-9-20-13-15/h5,7,9,13,16H,3-4,6,8,10-12,14H2,1-2H3,(H,21,23)(H,22,25) |
| InChIKey | CMWXDRMHLSAHBU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|