C15H31IN4O4S — CID 110993708
ethyl 1-[N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993708) has the molecular formula C15H31IN4O4S and a molecular weight of 490.41 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993708 |
| Molecular Formula | C15H31IN4O4S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C15H30N4O4S.HI/c1-4-16-15(17-9-10-18-24(21,22)6-3)19-11-7-8-13(12-19)14(20)23-5-2;/h13,18H,4-12H2,1-3H3,(H,16,17);1H |
| InChIKey | CMGXURYSWMHMJE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|