C15H26IN5O3 — CID 110995068
ethyl 1-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110995068) has the molecular formula C15H26IN5O3 and a molecular weight of 451.31 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110995068 |
| Molecular Formula | C15H26IN5O3 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)no1)N1CCCC(C(=O)OCC)C1.I |
| InChI | InChI=1S/C15H25N5O3.HI/c1-4-16-15(17-9-13-18-11(3)19-23-13)20-8-6-7-12(10-20)14(21)22-5-2;/h12H,4-10H2,1-3H3,(H,16,17);1H |
| InChIKey | KQRBDIQLTWYYKF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|