C14H25IN6O3 — CID 111163039
ethyl 4-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111163039) has the molecular formula C14H25IN6O3 and a molecular weight of 452.30 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111163039 |
| Molecular Formula | C14H25IN6O3 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C)no1)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C14H24N6O3.HI/c1-4-15-13(16-10-12-17-11(3)18-23-12)19-6-8-20(9-7-19)14(21)22-5-2;/h4-10H2,1-3H3,(H,15,16);1H |
| InChIKey | NRMNSVBFRPRHQU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|