C15H24IN5O2 — CID 111048573
4-[[[amino(diethylamino)methylidene]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide;hydroiodide (PubChem CID 111048573) has the molecular formula C15H24IN5O2 and a molecular weight of 433.29 g/mol. Its IUPAC name is 4-[[[amino(diethylamino)methylidene]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide;hydroiodide.
| Compound Name | 4-[[[amino(diethylamino)methylidene]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide;hydroiodide |
|---|---|
| PubChem CID | 111048573 |
| Molecular Formula | C15H24IN5O2 |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 4-[[[amino(diethylamino)methylidene]amino]methyl]-N-(2-amino-2-oxoethyl)benzamide;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/Cc1ccc(C(=O)NCC(N)=O)cc1.I |
| InChI | InChI=1S/C15H23N5O2.HI/c1-3-20(4-2)15(17)19-9-11-5-7-12(8-6-11)14(22)18-10-13(16)21;/h5-8H,3-4,9-10H2,1-2H3,(H2,16,21)(H2,17,19)(H,18,22);1H |
| InChIKey | BZIOOIVZQHMXDQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|