C16H28IN3 — CID 111045461
2-[(4-tert-butylphenyl)methyl]-1,1-diethylguanidine;hydroiodide (PubChem CID 111045461) has the molecular formula C16H28IN3 and a molecular weight of 389.33 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-1,1-diethylguanidine;hydroiodide.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-1,1-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111045461 |
| Molecular Formula | C16H28IN3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-1,1-diethylguanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/Cc1ccc(C(C)(C)C)cc1.I |
| InChI | InChI=1S/C16H27N3.HI/c1-6-19(7-2)15(17)18-12-13-8-10-14(11-9-13)16(3,4)5;/h8-11H,6-7,12H2,1-5H3,(H2,17,18);1H |
| InChIKey | CCGVZRXPNNIFRA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|