C12H18BrN3 — CID 111044516
2-[(3-bromophenyl)methyl]-1,1-diethylguanidine (PubChem CID 111044516) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-1,1-diethylguanidine.
| Compound Name | 2-[(3-bromophenyl)methyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111044516 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/Cc1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrN3/c1-3-16(4-2)12(14)15-9-10-6-5-7-11(13)8-10/h5-8H,3-4,9H2,1-2H3,(H2,14,15) |
| InChIKey | SGXIXCMFLHCDHD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|