C18H23N3O — CID 111069350
1,1-diethyl-2-[(3-phenoxyphenyl)methyl]guanidine (PubChem CID 111069350) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1,1-diethyl-2-[(3-phenoxyphenyl)methyl]guanidine.
| Compound Name | 1,1-diethyl-2-[(3-phenoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111069350 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1,1-diethyl-2-[(3-phenoxyphenyl)methyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C18H23N3O/c1-3-21(4-2)18(19)20-14-15-9-8-12-17(13-15)22-16-10-6-5-7-11-16/h5-13H,3-4,14H2,1-2H3,(H2,19,20) |
| InChIKey | LCZNESAYFDKTSN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|