C22H32IN3O — CID 111807463
1,1-diethyl-2-[2-[3-(3-phenylpropoxy)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111807463) has the molecular formula C22H32IN3O and a molecular weight of 481.42 g/mol. Its IUPAC name is 1,1-diethyl-2-[2-[3-(3-phenylpropoxy)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[2-[3-(3-phenylpropoxy)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807463 |
| Molecular Formula | C22H32IN3O |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1,1-diethyl-2-[2-[3-(3-phenylpropoxy)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CCc1cccc(OCCCc2ccccc2)c1.I |
| InChI | InChI=1S/C22H31N3O.HI/c1-3-25(4-2)22(23)24-16-15-20-12-8-14-21(18-20)26-17-9-13-19-10-6-5-7-11-19;/h5-8,10-12,14,18H,3-4,9,13,15-17H2,1-2H3,(H2,23,24);1H |
| InChIKey | UHPBLUQFXPYOOF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|