About 2-(3-bromophenyl)-N'-methylethanimidamide
2-(3-bromophenyl)-N'-methylethanimidamide (PubChem CID 63181979) has the molecular formula C9H11BrN2
and a molecular weight of 227.11 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)-N'-methylethanimidamide |
| PubChem CID | 63181979 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.11 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-(3-bromophenyl)-N'-methylethanimidamide |
| SMILES | C/N=C(\N)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C9H11BrN2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3,(H2,11,12) |
| InChIKey | XYUDMRDFPGIWEZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.11 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromophenyl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)-N'-methylethanimidamide?
The IUPAC name of 2-(3-bromophenyl)-N'-methylethanimidamide (CID 63181979) is 2-(3-bromophenyl)-N'-methylethanimidamide.
What is the SMILES notation for 2-(3-bromophenyl)-N'-methylethanimidamide?
The canonical SMILES for 2-(3-bromophenyl)-N'-methylethanimidamide is C/N=C(\N)Cc1cccc(Br)c1.
What is the InChIKey of 2-(3-bromophenyl)-N'-methylethanimidamide?
The InChIKey is XYUDMRDFPGIWEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3,(H2,11,12).
What are the key properties of 2-(3-bromophenyl)-N'-methylethanimidamide?
2-(3-bromophenyl)-N'-methylethanimidamide has a molecular weight of 227.11 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)-N'-methylethanimidamide is sourced from PubChem (CID 63181979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).