About 2-(3-bromophenyl)acetate
2-(3-bromophenyl)acetate (PubChem CID 3608673) has the molecular formula C8H6BrO2-
and a molecular weight of 214.04 g/mol. Its IUPAC name is 2-(3-bromophenyl)acetate.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)acetate |
| PubChem CID | 3608673 |
| Molecular Formula | C8H6BrO2- |
| Molecular Weight | 214.04 g/mol |
| Exact Mass | 212.96 |
| IUPAC Name | 2-(3-bromophenyl)acetate |
| SMILES | O=C([O-])Cc1cccc(Br)c1 |
| InChI | InChI=1S/C8H7BrO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
| InChIKey | KYNNBXCGXUOREX-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.04 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)acetate?
The IUPAC name of 2-(3-bromophenyl)acetate (CID 3608673) is 2-(3-bromophenyl)acetate.
What is the SMILES notation for 2-(3-bromophenyl)acetate?
The canonical SMILES for 2-(3-bromophenyl)acetate is O=C([O-])Cc1cccc(Br)c1.
What is the InChIKey of 2-(3-bromophenyl)acetate?
The InChIKey is KYNNBXCGXUOREX-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7BrO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1.
What are the key properties of 2-(3-bromophenyl)acetate?
2-(3-bromophenyl)acetate has a molecular weight of 214.04 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)acetate is sourced from PubChem (CID 3608673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).