About iodo 2-(3-bromophenyl)acetate
iodo 2-(3-bromophenyl)acetate (PubChem CID 155449676) has the molecular formula C8H6BrIO2
and a molecular weight of 340.94 g/mol. Its IUPAC name is iodo 2-(3-bromophenyl)acetate.
Molecular Properties
| Compound Name | iodo 2-(3-bromophenyl)acetate |
| PubChem CID | 155449676 |
| Molecular Formula | C8H6BrIO2 |
| Molecular Weight | 340.94 g/mol |
| Exact Mass | 339.86 |
| IUPAC Name | iodo 2-(3-bromophenyl)acetate |
| SMILES | O=C(Cc1cccc(Br)c1)OI |
| InChI | InChI=1S/C8H6BrIO2/c9-7-3-1-2-6(4-7)5-8(11)12-10/h1-4H,5H2 |
| InChIKey | ONYDKTFOVUWVCR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.94 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodo 2-(3-bromophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo 2-(3-bromophenyl)acetate?
The IUPAC name of iodo 2-(3-bromophenyl)acetate (CID 155449676) is iodo 2-(3-bromophenyl)acetate.
What is the SMILES notation for iodo 2-(3-bromophenyl)acetate?
The canonical SMILES for iodo 2-(3-bromophenyl)acetate is O=C(Cc1cccc(Br)c1)OI.
What is the InChIKey of iodo 2-(3-bromophenyl)acetate?
The InChIKey is ONYDKTFOVUWVCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrIO2/c9-7-3-1-2-6(4-7)5-8(11)12-10/h1-4H,5H2.
What are the key properties of iodo 2-(3-bromophenyl)acetate?
iodo 2-(3-bromophenyl)acetate has a molecular weight of 340.94 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodo 2-(3-bromophenyl)acetate is sourced from PubChem (CID 155449676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).