About 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium
2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium (PubChem CID 139147193) has the molecular formula C16H18BrNO2
and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium |
| PubChem CID | 139147193 |
| Molecular Formula | C16H18BrNO2 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium |
| SMILES | C[C@@H]([NH3+])c1ccccc1.O=C([O-])Cc1cccc(Br)c1 |
| InChI | InChI=1S/C8H7BrO2.C8H11N/c9-7-3-1-2-6(4-7)5-8(10)11;1-7(9)8-5-3-2-4-6-8/h1-4H,5H2,(H,10,11);2-7H,9H2,1H3/t;7-/m.1/s1 |
| InChIKey | UXAVOOVEADUOMK-HMZWWLAASA-N |
| XLogP | 1.73 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium?
The IUPAC name of 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium (CID 139147193) is 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium.
What is the SMILES notation for 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium?
The canonical SMILES for 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium is C[C@@H]([NH3+])c1ccccc1.O=C([O-])Cc1cccc(Br)c1.
What is the InChIKey of 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium?
The InChIKey is UXAVOOVEADUOMK-HMZWWLAASA-N. The full InChI is InChI=1S/C8H7BrO2.C8H11N/c9-7-3-1-2-6(4-7)5-8(10)11;1-7(9)8-5-3-2-4-6-8/h1-4H,5H2,(H,10,11);2-7H,9H2,1H3/t;7-/m.1/s1.
What are the key properties of 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium?
2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium has a molecular weight of 336.23 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)acetate;[(1R)-1-phenylethyl]azanium is sourced from PubChem (CID 139147193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).