C22H20BrNO — CID 133189902
2-(3-bromophenyl)-N-[(3-methylphenyl)-phenylmethyl]acetamide (PubChem CID 133189902) has the molecular formula C22H20BrNO and a molecular weight of 394.31 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-[(3-methylphenyl)-phenylmethyl]acetamide.
| Compound Name | 2-(3-bromophenyl)-N-[(3-methylphenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 133189902 |
| Molecular Formula | C22H20BrNO |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-(3-bromophenyl)-N-[(3-methylphenyl)-phenylmethyl]acetamide |
| SMILES | Cc1cccc(C(NC(=O)Cc2cccc(Br)c2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H20BrNO/c1-16-7-5-11-19(13-16)22(18-9-3-2-4-10-18)24-21(25)15-17-8-6-12-20(23)14-17/h2-14,22H,15H2,1H3,(H,24,25) |
| InChIKey | RQNQJYXVTKFEBL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |