C20H23N3O3 — CID 140999664
(2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-methylphenyl)acetyl]amino]propanamide (PubChem CID 140999664) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-methylphenyl)acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-methylphenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 140999664 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-methylphenyl)acetyl]amino]propanamide |
| SMILES | Cc1cccc(CC(=O)N[C@@H](C)C(=O)NC(=O)[C@H](N)c2ccccc2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-13-7-6-8-15(11-13)12-17(24)22-14(2)19(25)23-20(26)18(21)16-9-4-3-5-10-16/h3-11,14,18H,12,21H2,1-2H3,(H,22,24)(H,23,25,26)/t14-,18+/m0/s1 |
| InChIKey | XRHTZAHTARXZMC-KBXCAEBGSA-N |
| XLogP | 1.39 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |