C19H20FN3O3 — CID 140999621
(2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-fluorophenyl)acetyl]amino]propanamide (PubChem CID 140999621) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is (2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-fluorophenyl)acetyl]amino]propanamide.
| Compound Name | (2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-fluorophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 140999621 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (2S)-N-[(2R)-2-amino-2-phenylacetyl]-2-[[2-(3-fluorophenyl)acetyl]amino]propanamide |
| SMILES | C[C@H](NC(=O)Cc1cccc(F)c1)C(=O)NC(=O)[C@H](N)c1ccccc1 |
| InChI | InChI=1S/C19H20FN3O3/c1-12(22-16(24)11-13-6-5-9-15(20)10-13)18(25)23-19(26)17(21)14-7-3-2-4-8-14/h2-10,12,17H,11,21H2,1H3,(H,22,24)(H,23,25,26)/t12-,17+/m0/s1 |
| InChIKey | DIRCMTDOBITJPA-YVEFUNNKSA-N |
| XLogP | 1.22 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |