C23H22FNO — CID 46436394
N-(1,1-diphenylpropan-2-yl)-2-(3-fluorophenyl)acetamide (PubChem CID 46436394) has the molecular formula C23H22FNO and a molecular weight of 347.43 g/mol. Its IUPAC name is N-(1,1-diphenylpropan-2-yl)-2-(3-fluorophenyl)acetamide.
| Compound Name | N-(1,1-diphenylpropan-2-yl)-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 46436394 |
| Molecular Formula | C23H22FNO |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(1,1-diphenylpropan-2-yl)-2-(3-fluorophenyl)acetamide |
| SMILES | CC(NC(=O)Cc1cccc(F)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22FNO/c1-17(25-22(26)16-18-9-8-14-21(24)15-18)23(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-15,17,23H,16H2,1H3,(H,25,26) |
| InChIKey | KPUXSYUWURVGHS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |