C9H12BrN5 — CID 23637934
2-[(3-bromophenyl)methyl]-1-(diaminomethylidene)guanidine (PubChem CID 23637934) has the molecular formula C9H12BrN5 and a molecular weight of 270.13 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[(3-bromophenyl)methyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 23637934 |
| Molecular Formula | C9H12BrN5 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/Cc1cccc(Br)c1 |
| InChI | InChI=1S/C9H12BrN5/c10-7-3-1-2-6(4-7)5-14-9(13)15-8(11)12/h1-4H,5H2,(H6,11,12,13,14,15) |
| InChIKey | XRUWNTAKPLUSEG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|