C10H14ClN5O2 — CID 18950021
2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 18950021) has the molecular formula C10H14ClN5O2 and a molecular weight of 271.71 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)guanidine;hydrochloride.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)guanidine;hydrochloride |
|---|---|
| PubChem CID | 18950021 |
| Molecular Formula | C10H14ClN5O2 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(N)=N/Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H13N5O2.ClH/c11-9(12)15-10(13)14-4-6-1-2-7-8(3-6)17-5-16-7;/h1-3H,4-5H2,(H6,11,12,13,14,15);1H |
| InChIKey | AILLSXXSBZTFBF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|