About 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride
2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride (PubChem CID 67372832) has the molecular formula C14H22ClN5O2
and a molecular weight of 327.82 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride |
| PubChem CID | 67372832 |
| Molecular Formula | C14H22ClN5O2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride |
| SMILES | CC(C)(C)N/C(N=C(N)N)=N/Cc1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C14H21N5O2.ClH/c1-14(2,3)19-13(18-12(15)16)17-7-9-4-5-10-11(6-9)21-8-20-10;/h4-6H,7-8H2,1-3H3,(H5,15,16,17,18,19);1H |
| InChIKey | LFWDDAFZZFSQNE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride?
The IUPAC name of 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride (CID 67372832) is 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride.
What is the SMILES notation for 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride?
The canonical SMILES for 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride is CC(C)(C)N/C(N=C(N)N)=N/Cc1ccc2c(c1)OCO2.Cl.
What is the InChIKey of 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride?
The InChIKey is LFWDDAFZZFSQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O2.ClH/c1-14(2,3)19-13(18-12(15)16)17-7-9-4-5-10-11(6-9)21-8-20-10;/h4-6H,7-8H2,1-3H3,(H5,15,16,17,18,19);1H.
What are the key properties of 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride?
2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride has a molecular weight of 327.82 g/mol, XLogP of 1.35, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-ylmethyl)-1-tert-butyl-3-(diaminomethylidene)guanidine;hydrochloride is sourced from PubChem (CID 67372832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).